C25H45ClO4 — CID 71468866
(1R)-1-[(2S,3R,5S)-3-chloro-5-[(2R,5R)-5-[(1R)-1-hydroxyhex-5-enyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol (PubChem CID 71468866) has the molecular formula C25H45ClO4 and a molecular weight of 445.08 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,5S)-3-chloro-5-[(2R,5R)-5-[(1R)-1-hydroxyhex-5-enyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol.
| Compound Name | (1R)-1-[(2S,3R,5S)-3-chloro-5-[(2R,5R)-5-[(1R)-1-hydroxyhex-5-enyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 71468866 |
| Molecular Formula | C25H45ClO4 |
| Molecular Weight | 445.08 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | (1R)-1-[(2S,3R,5S)-3-chloro-5-[(2R,5R)-5-[(1R)-1-hydroxyhex-5-enyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
| SMILES | C=CCCC[C@@H](O)[C@H]1CC[C@H]([C@@H]2C[C@@H](Cl)[C@H]([C@H](O)CCCCCCCCCC)O2)O1 |
| InChI | InChI=1S/C25H45ClO4/c1-3-5-7-8-9-10-11-13-15-21(28)25-19(26)18-24(30-25)23-17-16-22(29-23)20(27)14-12-6-4-2/h4,19-25,27-28H,2-3,5-18H2,1H3/t19-,20-,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | ZLRIEICHXOGSDH-OZSWJIHKSA-N |
| XLogP | 5.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.08 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|