C19H34O4 — CID 11099459
(5R)-5-[(2R,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-one (PubChem CID 11099459) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (5R)-5-[(2R,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-one.
| Compound Name | (5R)-5-[(2R,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 11099459 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (5R)-5-[(2R,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-one |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@H]([C@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C19H34O4/c1-2-3-4-5-6-7-8-9-10-15(20)16-11-12-17(22-16)18-13-14-19(21)23-18/h15-18,20H,2-14H2,1H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | ZAWFKMSJAYLCBI-BRSBDYLESA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|