C15H28O4 — CID 10849816
(5S)-5-[(1S)-1,5-dihydroxyundecyl]oxolan-2-one (PubChem CID 10849816) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (5S)-5-[(1S)-1,5-dihydroxyundecyl]oxolan-2-one.
| Compound Name | (5S)-5-[(1S)-1,5-dihydroxyundecyl]oxolan-2-one |
|---|---|
| PubChem CID | 10849816 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (5S)-5-[(1S)-1,5-dihydroxyundecyl]oxolan-2-one |
| SMILES | CCCCCCC(O)CCC[C@H](O)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C15H28O4/c1-2-3-4-5-7-12(16)8-6-9-13(17)14-10-11-15(18)19-14/h12-14,16-17H,2-11H2,1H3/t12?,13-,14-/m0/s1 |
| InChIKey | UNNGPNUFVSHDRX-TTZKSVMKSA-N |
| XLogP | 2.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|