C15H26O6 — CID 23928039
(4E)-3,6,7-trihydroxy-2-(1-hydroxyhexyl)-2,3,6,7,8,9-hexahydrooxecin-10-one (PubChem CID 23928039) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4E)-3,6,7-trihydroxy-2-(1-hydroxyhexyl)-2,3,6,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (4E)-3,6,7-trihydroxy-2-(1-hydroxyhexyl)-2,3,6,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 23928039 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (4E)-3,6,7-trihydroxy-2-(1-hydroxyhexyl)-2,3,6,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCC(O)C1OC(=O)CCC(O)C(O)/C=C/C1O |
| InChI | InChI=1S/C15H26O6/c1-2-3-4-5-12(18)15-13(19)7-6-10(16)11(17)8-9-14(20)21-15/h6-7,10-13,15-19H,2-5,8-9H2,1H3/b7-6+ |
| InChIKey | DSSKUWLGIXVRKE-VOTSOKGWSA-N |
| XLogP | 0.27 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|