C26H46O5 — CID 10717884
(5R)-5-[(Z,1R)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyhept-4-enyl]oxolan-2-one (PubChem CID 10717884) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is (5R)-5-[(Z,1R)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyhept-4-enyl]oxolan-2-one.
| Compound Name | (5R)-5-[(Z,1R)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyhept-4-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 10717884 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | (5R)-5-[(Z,1R)-7-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-hydroxyhept-4-enyl]oxolan-2-one |
| SMILES | CCCCCCCCCC[C@@H]1OC(C)(C)O[C@@H]1CC/C=C\CC[C@@H](O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C26H46O5/c1-4-5-6-7-8-9-10-14-17-23-24(31-26(2,3)30-23)18-15-12-11-13-16-21(27)22-19-20-25(28)29-22/h11-12,21-24,27H,4-10,13-20H2,1-3H3/b12-11-/t21-,22-,23+,24-/m1/s1 |
| InChIKey | CJNMGYGZAATQQE-CYUZAEKLSA-N |
| XLogP | 6.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|