C16H30O2 — CID 10538904
(4R,5R)-4-butyl-5-[(Z)-hept-3-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10538904) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (4R,5R)-4-butyl-5-[(Z)-hept-3-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-butyl-5-[(Z)-hept-3-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10538904 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (4R,5R)-4-butyl-5-[(Z)-hept-3-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCC/C=C\CC[C@H]1OC(C)(C)O[C@@H]1CCCC |
| InChI | InChI=1S/C16H30O2/c1-5-7-9-10-11-13-15-14(12-8-6-2)17-16(3,4)18-15/h9-10,14-15H,5-8,11-13H2,1-4H3/b10-9-/t14-,15-/m1/s1 |
| InChIKey | XXXWUBBHYGZQJB-KMUBWGIJSA-N |
| XLogP | 4.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|