C24H44O8S — CID 11420494
[(1S,4R,5R)-4,5-dihydroxy-1-[(2R,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]pentadecyl] methanesulfonate (PubChem CID 11420494) has the molecular formula C24H44O8S and a molecular weight of 492.68 g/mol. Its IUPAC name is [(1S,4R,5R)-4,5-dihydroxy-1-[(2R,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]pentadecyl] methanesulfonate.
| Compound Name | [(1S,4R,5R)-4,5-dihydroxy-1-[(2R,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]pentadecyl] methanesulfonate |
|---|---|
| PubChem CID | 11420494 |
| Molecular Formula | C24H44O8S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | [(1S,4R,5R)-4,5-dihydroxy-1-[(2R,5R)-5-[(2R)-5-oxooxolan-2-yl]oxolan-2-yl]pentadecyl] methanesulfonate |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H](O)CC[C@H](OS(C)(=O)=O)[C@H]1CC[C@H]([C@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C24H44O8S/c1-3-4-5-6-7-8-9-10-11-18(25)19(26)12-13-23(32-33(2,28)29)22-15-14-20(30-22)21-16-17-24(27)31-21/h18-23,25-26H,3-17H2,1-2H3/t18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | OYVMBDFAERCCRP-RCQJKQRMSA-N |
| XLogP | 3.62 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|