C23H32O6 — CID 11177177
(5S)-5-[(2S,5S)-5-[(2S,5S)-5-[(1R)-1-hydroxy-4-phenylmethoxybutyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one (PubChem CID 11177177) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (5S)-5-[(2S,5S)-5-[(2S,5S)-5-[(1R)-1-hydroxy-4-phenylmethoxybutyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one.
| Compound Name | (5S)-5-[(2S,5S)-5-[(2S,5S)-5-[(1R)-1-hydroxy-4-phenylmethoxybutyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 11177177 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (5S)-5-[(2S,5S)-5-[(2S,5S)-5-[(1R)-1-hydroxy-4-phenylmethoxybutyl]oxolan-2-yl]oxolan-2-yl]oxolan-2-one |
| SMILES | O=C1CC[C@@H]([C@@H]2CC[C@@H]([C@@H]3CC[C@@H]([C@H](O)CCCOCc4ccccc4)O3)O2)O1 |
| InChI | InChI=1S/C23H32O6/c24-17(7-4-14-26-15-16-5-2-1-3-6-16)18-8-9-19(27-18)20-10-11-21(28-20)22-12-13-23(25)29-22/h1-3,5-6,17-22,24H,4,7-15H2/t17-,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | AQJOLFDOLKLMQU-GUCLMQHLSA-N |
| XLogP | 3.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|