C23H38O3 — CID 11545059
(1R)-1-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]undecan-1-ol (PubChem CID 11545059) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (1R)-1-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]undecan-1-ol.
| Compound Name | (1R)-1-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 11545059 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (1R)-1-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]undecan-1-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C23H38O3/c1-2-3-4-5-6-7-8-12-15-22(24)23-17-16-21(26-23)19-25-18-20-13-10-9-11-14-20/h9-11,13-14,21-24H,2-8,12,15-19H2,1H3/t21-,22-,23-/m1/s1 |
| InChIKey | WXFTZEDZNRRTBO-DNVJHFABSA-N |
| XLogP | 5.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|