C27H44O4 — CID 16756044
(1R,3R)-1-[(2R,5R)-5-[(1R)-1-phenylmethoxyundecyl]oxolan-2-yl]pent-4-ene-1,3-diol (PubChem CID 16756044) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (1R,3R)-1-[(2R,5R)-5-[(1R)-1-phenylmethoxyundecyl]oxolan-2-yl]pent-4-ene-1,3-diol.
| Compound Name | (1R,3R)-1-[(2R,5R)-5-[(1R)-1-phenylmethoxyundecyl]oxolan-2-yl]pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 16756044 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (1R,3R)-1-[(2R,5R)-5-[(1R)-1-phenylmethoxyundecyl]oxolan-2-yl]pent-4-ene-1,3-diol |
| SMILES | C=C[C@H](O)C[C@@H](O)[C@H]1CC[C@H]([C@@H](CCCCCCCCCC)OCc2ccccc2)O1 |
| InChI | InChI=1S/C27H44O4/c1-3-5-6-7-8-9-10-14-17-26(30-21-22-15-12-11-13-16-22)27-19-18-25(31-27)24(29)20-23(28)4-2/h4,11-13,15-16,23-29H,2-3,5-10,14,17-21H2,1H3/t23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | IFIZLCIWVXTJLP-LDTQXXFPSA-N |
| XLogP | 5.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|