C25H38O3 — CID 11710777
(1S)-1-[(2S,3R,6S)-2-decyl-3-phenylmethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol (PubChem CID 11710777) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1S)-1-[(2S,3R,6S)-2-decyl-3-phenylmethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol.
| Compound Name | (1S)-1-[(2S,3R,6S)-2-decyl-3-phenylmethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11710777 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (1S)-1-[(2S,3R,6S)-2-decyl-3-phenylmethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H](O)[C@@H]1C=C[C@@H](OCc2ccccc2)[C@H](CCCCCCCCCC)O1 |
| InChI | InChI=1S/C25H38O3/c1-3-5-6-7-8-9-10-14-17-25-24(19-18-23(28-25)22(26)4-2)27-20-21-15-12-11-13-16-21/h4,11-13,15-16,18-19,22-26H,2-3,5-10,14,17,20H2,1H3/t22-,23-,24+,25-/m0/s1 |
| InChIKey | FDLCJXSJERRFQB-JBXUNAHCSA-N |
| XLogP | 5.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|