C20H30O3 — CID 130262414
(2R,3R,5R)-5-[(1R)-1-phenylmethoxyhexyl]-2-prop-2-enyloxolan-3-ol (PubChem CID 130262414) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R,3R,5R)-5-[(1R)-1-phenylmethoxyhexyl]-2-prop-2-enyloxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-[(1R)-1-phenylmethoxyhexyl]-2-prop-2-enyloxolan-3-ol |
|---|---|
| PubChem CID | 130262414 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3R,5R)-5-[(1R)-1-phenylmethoxyhexyl]-2-prop-2-enyloxolan-3-ol |
| SMILES | C=CC[C@H]1O[C@@H]([C@@H](CCCCC)OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C20H30O3/c1-3-5-7-13-19(22-15-16-11-8-6-9-12-16)20-14-17(21)18(23-20)10-4-2/h4,6,8-9,11-12,17-21H,2-3,5,7,10,13-15H2,1H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | YZHRQYFUJALXPR-UAFMIMERSA-N |
| XLogP | 4.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|