C32H48O2S — CID 134878025
(6S)-6-[(1S)-1-phenylmethoxyundecyl]-2-phenylsulfanyl-2-propan-2-yloxane (PubChem CID 134878025) has the molecular formula C32H48O2S and a molecular weight of 496.80 g/mol. Its IUPAC name is (6S)-6-[(1S)-1-phenylmethoxyundecyl]-2-phenylsulfanyl-2-propan-2-yloxane.
| Compound Name | (6S)-6-[(1S)-1-phenylmethoxyundecyl]-2-phenylsulfanyl-2-propan-2-yloxane |
|---|---|
| PubChem CID | 134878025 |
| Molecular Formula | C32H48O2S |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (6S)-6-[(1S)-1-phenylmethoxyundecyl]-2-phenylsulfanyl-2-propan-2-yloxane |
| SMILES | CCCCCCCCCC[C@H](OCc1ccccc1)[C@@H]1CCCC(Sc2ccccc2)(C(C)C)O1 |
| InChI | InChI=1S/C32H48O2S/c1-4-5-6-7-8-9-10-17-23-30(33-26-28-19-13-11-14-20-28)31-24-18-25-32(34-31,27(2)3)35-29-21-15-12-16-22-29/h11-16,19-22,27,30-31H,4-10,17-18,23-26H2,1-3H3/t30-,31-,32?/m0/s1 |
| InChIKey | HWMUDWPDDCBWCF-PZWBPPBVSA-N |
| XLogP | 9.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|