C23H38O3 — CID 11164361
(2S)-6-methoxy-2-nonyl-2-(phenylmethoxymethyl)oxane (PubChem CID 11164361) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (2S)-6-methoxy-2-nonyl-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2S)-6-methoxy-2-nonyl-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 11164361 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (2S)-6-methoxy-2-nonyl-2-(phenylmethoxymethyl)oxane |
| SMILES | CCCCCCCCC[C@@]1(COCc2ccccc2)CCCC(OC)O1 |
| InChI | InChI=1S/C23H38O3/c1-3-4-5-6-7-8-12-17-23(18-13-16-22(24-2)26-23)20-25-19-21-14-10-9-11-15-21/h9-11,14-15,22H,3-8,12-13,16-20H2,1-2H3/t22?,23-/m0/s1 |
| InChIKey | NZLWRAVTTDBYNE-WCSIJFPASA-N |
| XLogP | 6.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|