C20H24O2 — CID 7832534
(2R,5S)-2-ethyl-5-phenyl-2-(phenylmethoxymethyl)oxolane (PubChem CID 7832534) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,5S)-2-ethyl-5-phenyl-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,5S)-2-ethyl-5-phenyl-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 7832534 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,5S)-2-ethyl-5-phenyl-2-(phenylmethoxymethyl)oxolane |
| SMILES | CC[C@]1(COCc2ccccc2)CC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H24O2/c1-2-20(16-21-15-17-9-5-3-6-10-17)14-13-19(22-20)18-11-7-4-8-12-18/h3-12,19H,2,13-16H2,1H3/t19-,20+/m0/s1 |
| InChIKey | VQOKAWUKGACKQM-VQTJNVASSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |