C19H28O2 — CID 101364458
(2R,3R)-2-cyclohexyl-3-ethyl-2-methyl-3-(phenylmethoxymethyl)oxirane (PubChem CID 101364458) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R,3R)-2-cyclohexyl-3-ethyl-2-methyl-3-(phenylmethoxymethyl)oxirane.
| Compound Name | (2R,3R)-2-cyclohexyl-3-ethyl-2-methyl-3-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 101364458 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2R,3R)-2-cyclohexyl-3-ethyl-2-methyl-3-(phenylmethoxymethyl)oxirane |
| SMILES | CC[C@]1(COCc2ccccc2)O[C@]1(C)C1CCCCC1 |
| InChI | InChI=1S/C19H28O2/c1-3-19(15-20-14-16-10-6-4-7-11-16)18(2,21-19)17-12-8-5-9-13-17/h4,6-7,10-11,17H,3,5,8-9,12-15H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | POTPEBWCPUDRBB-RTBURBONSA-N |
| XLogP | 4.72 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|