C21H28O5 — CID 11417090
(1S,8R,10S,11S)-5,5,10-trimethyl-10-(phenylmethoxymethyl)-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-ene-1,11-diol (PubChem CID 11417090) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1S,8R,10S,11S)-5,5,10-trimethyl-10-(phenylmethoxymethyl)-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-ene-1,11-diol.
| Compound Name | (1S,8R,10S,11S)-5,5,10-trimethyl-10-(phenylmethoxymethyl)-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-ene-1,11-diol |
|---|---|
| PubChem CID | 11417090 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1S,8R,10S,11S)-5,5,10-trimethyl-10-(phenylmethoxymethyl)-2,9-dioxatricyclo[6.3.1.04,12]dodec-4(12)-ene-1,11-diol |
| SMILES | CC1(C)CC[C@H]2O[C@@](C)(COCc3ccccc3)[C@H](O)[C@@]3(O)OCC1=C23 |
| InChI | InChI=1S/C21H28O5/c1-19(2)10-9-16-17-15(19)12-25-21(17,23)18(22)20(3,26-16)13-24-11-14-7-5-4-6-8-14/h4-8,16,18,22-23H,9-13H2,1-3H3/t16-,18+,20+,21+/m1/s1 |
| InChIKey | OFPVJSSQCGGSCQ-LGYWMIHWSA-N |
| XLogP | 2.56 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|