C16H24O3 — CID 11311604
(3R,4S)-3,7,7-trimethyl-4-phenylmethoxyoxepan-3-ol (PubChem CID 11311604) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3R,4S)-3,7,7-trimethyl-4-phenylmethoxyoxepan-3-ol.
| Compound Name | (3R,4S)-3,7,7-trimethyl-4-phenylmethoxyoxepan-3-ol |
|---|---|
| PubChem CID | 11311604 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3R,4S)-3,7,7-trimethyl-4-phenylmethoxyoxepan-3-ol |
| SMILES | CC1(C)CC[C@H](OCc2ccccc2)[C@](C)(O)CO1 |
| InChI | InChI=1S/C16H24O3/c1-15(2)10-9-14(16(3,17)12-19-15)18-11-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | DWIHXJXYPIWPEQ-GOEBONIOSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |