C18H24O5 — CID 10543686
(1S,4R,5R)-7,7-dimethoxy-1,5-dimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-one (PubChem CID 10543686) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is (1S,4R,5R)-7,7-dimethoxy-1,5-dimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-one.
| Compound Name | (1S,4R,5R)-7,7-dimethoxy-1,5-dimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-one |
|---|---|
| PubChem CID | 10543686 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1S,4R,5R)-7,7-dimethoxy-1,5-dimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]octan-6-one |
| SMILES | COC1(OC)C(=O)[C@]2(C)O[C@@]1(C)CC[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C18H24O5/c1-16-11-10-14(22-12-13-8-6-5-7-9-13)17(2,23-16)15(19)18(16,20-3)21-4/h5-9,14H,10-12H2,1-4H3/t14-,16+,17-/m1/s1 |
| InChIKey | KWFXELNLKQIPLR-HYVNUMGLSA-N |
| XLogP | 2.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|