C17H22O4 — CID 10401963
(3S,4R,5R,6R)-4-ethenyl-5-methoxy-6-phenylmethoxy-1-oxaspiro[2.5]octan-4-ol (PubChem CID 10401963) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3S,4R,5R,6R)-4-ethenyl-5-methoxy-6-phenylmethoxy-1-oxaspiro[2.5]octan-4-ol.
| Compound Name | (3S,4R,5R,6R)-4-ethenyl-5-methoxy-6-phenylmethoxy-1-oxaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 10401963 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3S,4R,5R,6R)-4-ethenyl-5-methoxy-6-phenylmethoxy-1-oxaspiro[2.5]octan-4-ol |
| SMILES | C=C[C@@]1(O)[C@H](OC)[C@H](OCc2ccccc2)CC[C@]12CO2 |
| InChI | InChI=1S/C17H22O4/c1-3-17(18)15(19-2)14(9-10-16(17)12-21-16)20-11-13-7-5-4-6-8-13/h3-8,14-15,18H,1,9-12H2,2H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | XURZIWMFQWFAHD-WCXIOVBPSA-N |
| XLogP | 2.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|