C20H28O4Si — CID 10247993
(3S,4R,5R,6R)-5-methoxy-6-phenylmethoxy-4-(2-trimethylsilylethynyl)-1-oxaspiro[2.5]octan-4-ol (PubChem CID 10247993) has the molecular formula C20H28O4Si and a molecular weight of 360.53 g/mol. Its IUPAC name is (3S,4R,5R,6R)-5-methoxy-6-phenylmethoxy-4-(2-trimethylsilylethynyl)-1-oxaspiro[2.5]octan-4-ol.
| Compound Name | (3S,4R,5R,6R)-5-methoxy-6-phenylmethoxy-4-(2-trimethylsilylethynyl)-1-oxaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 10247993 |
| Molecular Formula | C20H28O4Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3S,4R,5R,6R)-5-methoxy-6-phenylmethoxy-4-(2-trimethylsilylethynyl)-1-oxaspiro[2.5]octan-4-ol |
| SMILES | CO[C@@H]1[C@H](OCc2ccccc2)CC[C@]2(CO2)[C@@]1(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C20H28O4Si/c1-22-18-17(23-14-16-8-6-5-7-9-16)10-11-19(15-24-19)20(18,21)12-13-25(2,3)4/h5-9,17-18,21H,10-11,14-15H2,1-4H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | HCPMYYGJGBANEB-YSTOQKLRSA-N |
| XLogP | 2.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|