C26H27BrO5 — CID 54179875
(3R,4S,5R)-2-bromo-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 54179875) has the molecular formula C26H27BrO5 and a molecular weight of 499.40 g/mol. Its IUPAC name is (3R,4S,5R)-2-bromo-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5R)-2-bromo-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 54179875 |
| Molecular Formula | C26H27BrO5 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | (3R,4S,5R)-2-bromo-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | OC1(Br)OCC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H27BrO5/c27-26(28)25(31-18-22-14-8-3-9-15-22)24(30-17-21-12-6-2-7-13-21)23(19-32-26)29-16-20-10-4-1-5-11-20/h1-15,23-25,28H,16-19H2/t23?,24-,25+,26?/m0/s1 |
| InChIKey | PBAZGHRLDYBNGQ-OONXHFSZSA-N |
| XLogP | 4.81 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|