C22H24O5 — CID 10832829
(2R,3S,4R)-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolane-2-carboxylic acid (PubChem CID 10832829) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 10832829 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-prop-2-enyloxolane-2-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)OC[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H24O5/c1-2-13-22(21(23)24)20(26-15-18-11-7-4-8-12-18)19(16-27-22)25-14-17-9-5-3-6-10-17/h2-12,19-20H,1,13-16H2,(H,23,24)/t19-,20+,22-/m1/s1 |
| InChIKey | QGRDWDMTUYIOPJ-RZUBCFFCSA-N |
| XLogP | 3.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|