C17H24O4 — CID 11011793
(1S)-1-[(2R,3S,6S)-6-methoxy-3-phenylmethoxyoxan-2-yl]-2-methylprop-2-en-1-ol (PubChem CID 11011793) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1S)-1-[(2R,3S,6S)-6-methoxy-3-phenylmethoxyoxan-2-yl]-2-methylprop-2-en-1-ol.
| Compound Name | (1S)-1-[(2R,3S,6S)-6-methoxy-3-phenylmethoxyoxan-2-yl]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 11011793 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1S)-1-[(2R,3S,6S)-6-methoxy-3-phenylmethoxyoxan-2-yl]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)[C@H](O)[C@H]1O[C@H](OC)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-12(2)16(18)17-14(9-10-15(19-3)21-17)20-11-13-7-5-4-6-8-13/h4-8,14-18H,1,9-11H2,2-3H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | URVUXPNUWKMPGK-QAETUUGQSA-N |
| XLogP | 2.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|