C17H24O3 — CID 141490840
4,7,7-trimethyl-3-phenylmethoxy-6-oxabicyclo[3.2.1]octan-4-ol (PubChem CID 141490840) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4,7,7-trimethyl-3-phenylmethoxy-6-oxabicyclo[3.2.1]octan-4-ol.
| Compound Name | 4,7,7-trimethyl-3-phenylmethoxy-6-oxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 141490840 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4,7,7-trimethyl-3-phenylmethoxy-6-oxabicyclo[3.2.1]octan-4-ol |
| SMILES | CC1(C)OC2CC1CC(OCc1ccccc1)C2(C)O |
| InChI | InChI=1S/C17H24O3/c1-16(2)13-9-14(17(3,18)15(10-13)20-16)19-11-12-7-5-4-6-8-12/h4-8,13-15,18H,9-11H2,1-3H3 |
| InChIKey | CKSCSTPCRZOZPJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |