About dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane
dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane (PubChem CID 100983505) has the molecular formula C22H30O2Si
and a molecular weight of 354.57 g/mol. Its IUPAC name is dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane.
Molecular Properties
| Compound Name | dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane |
| PubChem CID | 100983505 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane |
| SMILES | C[C@@]1(COCc2ccccc2)CC[C@@H](C[Si](C)(C)c2ccccc2)O1 |
| InChI | InChI=1S/C22H30O2Si/c1-22(18-23-16-19-10-6-4-7-11-19)15-14-20(24-22)17-25(2,3)21-12-8-5-9-13-21/h4-13,20H,14-18H2,1-3H3/t20-,22-/m0/s1 |
| InChIKey | QLWKDMMIVOZGSQ-UNMCSNQZSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane?
The IUPAC name of dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane (CID 100983505) is dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane.
What is the SMILES notation for dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane?
The canonical SMILES for dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane is C[C@@]1(COCc2ccccc2)CC[C@@H](C[Si](C)(C)c2ccccc2)O1.
What is the InChIKey of dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane?
The InChIKey is QLWKDMMIVOZGSQ-UNMCSNQZSA-N. The full InChI is InChI=1S/C22H30O2Si/c1-22(18-23-16-19-10-6-4-7-11-19)15-14-20(24-22)17-25(2,3)21-12-8-5-9-13-21/h4-13,20H,14-18H2,1-3H3/t20-,22-/m0/s1.
What are the key properties of dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane?
dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane has a molecular weight of 354.57 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[[(2S,5S)-5-methyl-5-(phenylmethoxymethyl)oxolan-2-yl]methyl]-phenylsilane is sourced from PubChem (CID 100983505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).