C28H34O2Si — CID 102506117
tert-butyl-diphenyl-[[(2R,4S)-4-(phenylmethoxymethyl)oxetan-2-yl]methyl]silane (PubChem CID 102506117) has the molecular formula C28H34O2Si and a molecular weight of 430.66 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2R,4S)-4-(phenylmethoxymethyl)oxetan-2-yl]methyl]silane.
| Compound Name | tert-butyl-diphenyl-[[(2R,4S)-4-(phenylmethoxymethyl)oxetan-2-yl]methyl]silane |
|---|---|
| PubChem CID | 102506117 |
| Molecular Formula | C28H34O2Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | tert-butyl-diphenyl-[[(2R,4S)-4-(phenylmethoxymethyl)oxetan-2-yl]methyl]silane |
| SMILES | CC(C)(C)[Si](C[C@H]1C[C@@H](COCc2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O2Si/c1-28(2,3)31(26-15-9-5-10-16-26,27-17-11-6-12-18-27)22-25-19-24(30-25)21-29-20-23-13-7-4-8-14-23/h4-18,24-25H,19-22H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | PLOXYBTVIDIHQY-LOSJGSFVSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|