C32H40O4Si — CID 45379868
tert-butyl-[[(1R,3R,4R,5R,7R)-4-methyl-3-(phenylmethoxymethyl)-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-diphenylsilane (PubChem CID 45379868) has the molecular formula C32H40O4Si and a molecular weight of 516.75 g/mol. Its IUPAC name is tert-butyl-[[(1R,3R,4R,5R,7R)-4-methyl-3-(phenylmethoxymethyl)-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,3R,4R,5R,7R)-4-methyl-3-(phenylmethoxymethyl)-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 45379868 |
| Molecular Formula | C32H40O4Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | tert-butyl-[[(1R,3R,4R,5R,7R)-4-methyl-3-(phenylmethoxymethyl)-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-diphenylsilane |
| SMILES | C[C@H]1[C@H](COCc2ccccc2)O[C@@H]2C[C@H]1O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H40O4Si/c1-24-28-20-29(36-30(24)22-33-21-25-14-8-5-9-15-25)31(35-28)23-34-37(32(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,24,28-31H,20-23H2,1-4H3/t24-,28-,29-,30+,31-/m1/s1 |
| InChIKey | IAIHHVHUIZHKGC-RZBRXQIYSA-N |
| XLogP | 5.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|