C38H46O6SSi — CID 134844652
2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-2-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 134844652) has the molecular formula C38H46O6SSi and a molecular weight of 658.93 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-2-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134844652 |
| Molecular Formula | C38H46O6SSi |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-(phenylmethoxymethyl)oxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C38H46O6SSi/c1-38(2,3)46(32-21-13-7-14-22-32,33-23-15-8-16-24-33)43-26-25-35-34(29-45(39,40)31-19-11-6-12-20-31)37(41-4)36(44-35)28-42-27-30-17-9-5-10-18-30/h5-24,34-37H,25-29H2,1-4H3/t34-,35-,36+,37+/m0/s1 |
| InChIKey | IMFPJSHFUCTBTE-DNMDQSTESA-N |
| XLogP | 6.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|