C37H50O6Si — CID 102500168
tert-butyl-[(E)-6-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hex-4-enoxy]-diphenylsilane (PubChem CID 102500168) has the molecular formula C37H50O6Si and a molecular weight of 618.89 g/mol. Its IUPAC name is tert-butyl-[(E)-6-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hex-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-6-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hex-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102500168 |
| Molecular Formula | C37H50O6Si |
| Molecular Weight | 618.89 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | tert-butyl-[(E)-6-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-3-(methoxymethoxy)hex-4-enoxy]-diphenylsilane |
| SMILES | COCOC(/C=C/CC1OC(C)(C)OC1COCc1ccccc1)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H50O6Si/c1-36(2,3)44(32-20-12-8-13-21-32,33-22-14-9-15-23-33)41-26-25-31(40-29-38-6)19-16-24-34-35(43-37(4,5)42-34)28-39-27-30-17-10-7-11-18-30/h7-23,31,34-35H,24-29H2,1-6H3/b19-16+ |
| InChIKey | KFUGTOKEALENBZ-KNTRCKAVSA-N |
| XLogP | 6.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|