C30H40O4Si — CID 122386118
(Z)-4-[(4S,5S)-5-[(Z)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal (PubChem CID 122386118) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol. Its IUPAC name is (Z)-4-[(4S,5S)-5-[(Z)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal.
| Compound Name | (Z)-4-[(4S,5S)-5-[(Z)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal |
|---|---|
| PubChem CID | 122386118 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (Z)-4-[(4S,5S)-5-[(Z)-5-[tert-butyl(diphenyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enal |
| SMILES | CC1(C)O[C@@H](C/C=C\C=O)[C@H](C/C=C\CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C30H40O4Si/c1-29(2,3)35(25-17-9-6-10-18-25,26-19-11-7-12-20-26)32-24-16-8-13-21-27-28(22-14-15-23-31)34-30(4,5)33-27/h6-15,17-20,23,27-28H,16,21-22,24H2,1-5H3/b13-8-,15-14-/t27-,28-/m0/s1 |
| InChIKey | BNWYXGUXXQCOHE-JYXPVALWSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|