C32H36O5 — CID 67846326
(4R,6R,7R,11R,14S)-4,11-diphenyl-14-(phenylmethoxymethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane (PubChem CID 67846326) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is (4R,6R,7R,11R,14S)-4,11-diphenyl-14-(phenylmethoxymethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane.
| Compound Name | (4R,6R,7R,11R,14S)-4,11-diphenyl-14-(phenylmethoxymethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane |
|---|---|
| PubChem CID | 67846326 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (4R,6R,7R,11R,14S)-4,11-diphenyl-14-(phenylmethoxymethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecane |
| SMILES | c1ccc(COC[C@H]2CO[C@@]3(CCC[C@H](c4ccccc4)O3)[C@@]3(CCC[C@H](c4ccccc4)O3)O2)cc1 |
| InChI | InChI=1S/C32H36O5/c1-4-12-25(13-5-1)22-33-23-28-24-34-31(20-10-18-29(36-31)26-14-6-2-7-15-26)32(35-28)21-11-19-30(37-32)27-16-8-3-9-17-27/h1-9,12-17,28-30H,10-11,18-24H2/t28-,29+,30+,31+,32-/m0/s1 |
| InChIKey | CZBACGVLLUNJBC-ILNWVHSXSA-N |
| XLogP | 6.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |