C43H80O10Si — CID 10652851
[(4R,5S,8R)-5,8-bis(methoxymethoxy)-8-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]-4-(phenylmethoxymethoxy)octoxy]-tert-butyl-dimethylsilane (PubChem CID 10652851) has the molecular formula C43H80O10Si and a molecular weight of 785.19 g/mol. Its IUPAC name is [(4R,5S,8R)-5,8-bis(methoxymethoxy)-8-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]-4-(phenylmethoxymethoxy)octoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(4R,5S,8R)-5,8-bis(methoxymethoxy)-8-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]-4-(phenylmethoxymethoxy)octoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10652851 |
| Molecular Formula | C43H80O10Si |
| Molecular Weight | 785.19 g/mol |
| Exact Mass | 784.55 |
| IUPAC Name | [(4R,5S,8R)-5,8-bis(methoxymethoxy)-8-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]-4-(phenylmethoxymethoxy)octoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCCCCCCCC[C@H](OCOC)[C@H]1CC[C@H]([C@@H](CC[C@H](OCOC)[C@@H](CCCO[Si](C)(C)C(C)(C)C)OCOCc2ccccc2)OCOC)O1 |
| InChI | InChI=1S/C43H80O10Si/c1-10-11-12-13-14-15-16-20-24-38(48-32-44-5)41-28-29-42(53-41)40(50-34-46-7)27-26-39(49-33-45-6)37(25-21-30-52-54(8,9)43(2,3)4)51-35-47-31-36-22-18-17-19-23-36/h17-19,22-23,37-42H,10-16,20-21,24-35H2,1-9H3/t37-,38+,39+,40-,41-,42-/m1/s1 |
| InChIKey | RXKJPDRDAVQHCC-GUYMWZTLSA-N |
| XLogP | 10.17 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.19 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|