C22H34O8 — CID 10884421
ethyl (2S,3R,6S)-2,3-dihydroxy-6-(methoxymethoxy)-6-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]hexanoate (PubChem CID 10884421) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl (2S,3R,6S)-2,3-dihydroxy-6-(methoxymethoxy)-6-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]hexanoate.
| Compound Name | ethyl (2S,3R,6S)-2,3-dihydroxy-6-(methoxymethoxy)-6-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]hexanoate |
|---|---|
| PubChem CID | 10884421 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | ethyl (2S,3R,6S)-2,3-dihydroxy-6-(methoxymethoxy)-6-[(2S,5S)-5-(phenylmethoxymethyl)oxolan-2-yl]hexanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)CC[C@H](OCOC)[C@@H]1CC[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C22H34O8/c1-3-28-22(25)21(24)18(23)10-12-19(29-15-26-2)20-11-9-17(30-20)14-27-13-16-7-5-4-6-8-16/h4-8,17-21,23-24H,3,9-15H2,1-2H3/t17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | LHQYXEQNSDXMTD-SSTJLMRISA-N |
| XLogP | 1.80 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|