C35H42O11 — CID 177392717
diethyl (2R,3R)-2-hydroxy-3-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutanedioate (PubChem CID 177392717) has the molecular formula C35H42O11 and a molecular weight of 638.71 g/mol. Its IUPAC name is diethyl (2R,3R)-2-hydroxy-3-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutanedioate.
| Compound Name | diethyl (2R,3R)-2-hydroxy-3-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutanedioate |
|---|---|
| PubChem CID | 177392717 |
| Molecular Formula | C35H42O11 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | diethyl (2R,3R)-2-hydroxy-3-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutanedioate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O)C(=O)OCC |
| InChI | InChI=1S/C35H42O11/c1-3-41-33(38)28(36)32(34(39)42-4-2)46-35-29(37)31(44-22-26-18-12-7-13-19-26)30(43-21-25-16-10-6-11-17-25)27(45-35)23-40-20-24-14-8-5-9-15-24/h5-19,27-32,35-37H,3-4,20-23H2,1-2H3/t27-,28-,29-,30-,31-,32-,35-/m1/s1 |
| InChIKey | WJHMWWJHXHRWFZ-XDUSZWCRSA-N |
| XLogP | 3.33 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |