C38H42O8 — CID 142688383
ethyl 2-[[(2R,3R,4S,5R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]acetate (PubChem CID 142688383) has the molecular formula C38H42O8 and a molecular weight of 626.75 g/mol. Its IUPAC name is ethyl 2-[[(2R,3R,4S,5R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]acetate.
| Compound Name | ethyl 2-[[(2R,3R,4S,5R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 142688383 |
| Molecular Formula | C38H42O8 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | ethyl 2-[[(2R,3R,4S,5R)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methoxy]acetate |
| SMILES | CCOC(=O)COC[C@H]1OC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H42O8/c1-2-41-34(39)28-40-27-33-35(42-23-29-15-7-3-8-16-29)36(43-24-30-17-9-4-10-18-30)37(44-25-31-19-11-5-12-20-31)38(46-33)45-26-32-21-13-6-14-22-32/h3-22,33,35-38H,2,23-28H2,1H3/t33-,35-,36+,37-,38?/m1/s1 |
| InChIKey | HYIVQEHCBSVSIC-OOTDLNEOSA-N |
| XLogP | 6.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |