C34H48O7 — CID 177384739
(2S,4Z,7R)-2-[(1S)-1-(2-methoxyethoxymethoxy)heptyl]-6,7-bis(phenylmethoxy)-2,3,6,7,8,9-hexahydrooxecin-10-one (PubChem CID 177384739) has the molecular formula C34H48O7 and a molecular weight of 568.75 g/mol. Its IUPAC name is (2S,4Z,7R)-2-[(1S)-1-(2-methoxyethoxymethoxy)heptyl]-6,7-bis(phenylmethoxy)-2,3,6,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2S,4Z,7R)-2-[(1S)-1-(2-methoxyethoxymethoxy)heptyl]-6,7-bis(phenylmethoxy)-2,3,6,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 177384739 |
| Molecular Formula | C34H48O7 |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | (2S,4Z,7R)-2-[(1S)-1-(2-methoxyethoxymethoxy)heptyl]-6,7-bis(phenylmethoxy)-2,3,6,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCC[C@H](OCOCCOC)[C@@H]1C/C=C\C(OCc2ccccc2)[C@H](OCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C34H48O7/c1-3-4-5-12-18-31(40-27-37-24-23-36-2)33-20-13-19-30(38-25-28-14-8-6-9-15-28)32(21-22-34(35)41-33)39-26-29-16-10-7-11-17-29/h6-11,13-17,19,30-33H,3-5,12,18,20-27H2,1-2H3/b19-13-/t30?,31-,32+,33-/m0/s1 |
| InChIKey | FHTQDKHLGLMDOF-KLECUZCOSA-N |
| XLogP | 6.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|