C21H36O6 — CID 11199976
(3aR,8S,10E,11aR)-8-[(1S)-1-(methoxymethoxy)heptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one (PubChem CID 11199976) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is (3aR,8S,10E,11aR)-8-[(1S)-1-(methoxymethoxy)heptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one.
| Compound Name | (3aR,8S,10E,11aR)-8-[(1S)-1-(methoxymethoxy)heptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one |
|---|---|
| PubChem CID | 11199976 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3aR,8S,10E,11aR)-8-[(1S)-1-(methoxymethoxy)heptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one |
| SMILES | CCCCCC[C@H](OCOC)[C@@H]1C/C=C/[C@H]2OC(C)(C)O[C@@H]2CCC(=O)O1 |
| InChI | InChI=1S/C21H36O6/c1-5-6-7-8-10-16(24-15-23-4)17-11-9-12-18-19(13-14-20(22)25-17)27-21(2,3)26-18/h9,12,16-19H,5-8,10-11,13-15H2,1-4H3/b12-9+/t16-,17-,18+,19+/m0/s1 |
| InChIKey | PZJVRLXYVZDJOX-WTUHJVBQSA-N |
| XLogP | 4.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|