C25H40O8 — CID 44603583
(1S,2E,4S,6S,8S,12S,14E,16S)-8-[(1S,3R)-4-hydroxy-1-(methoxymethoxy)-3-methylbutyl]-12,18,18-trimethyl-5,9,17,19-tetraoxatricyclo[14.3.0.04,6]nonadeca-2,14-dien-10-one (PubChem CID 44603583) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is (1S,2E,4S,6S,8S,12S,14E,16S)-8-[(1S,3R)-4-hydroxy-1-(methoxymethoxy)-3-methylbutyl]-12,18,18-trimethyl-5,9,17,19-tetraoxatricyclo[14.3.0.04,6]nonadeca-2,14-dien-10-one.
| Compound Name | (1S,2E,4S,6S,8S,12S,14E,16S)-8-[(1S,3R)-4-hydroxy-1-(methoxymethoxy)-3-methylbutyl]-12,18,18-trimethyl-5,9,17,19-tetraoxatricyclo[14.3.0.04,6]nonadeca-2,14-dien-10-one |
|---|---|
| PubChem CID | 44603583 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1S,2E,4S,6S,8S,12S,14E,16S)-8-[(1S,3R)-4-hydroxy-1-(methoxymethoxy)-3-methylbutyl]-12,18,18-trimethyl-5,9,17,19-tetraoxatricyclo[14.3.0.04,6]nonadeca-2,14-dien-10-one |
| SMILES | COCO[C@@H](C[C@@H](C)CO)[C@@H]1C[C@@H]2O[C@H]2/C=C/[C@@H]2OC(C)(C)O[C@H]2/C=C/C[C@H](C)CC(=O)O1 |
| InChI | InChI=1S/C25H40O8/c1-16-7-6-8-19-20(33-25(3,4)32-19)10-9-18-22(30-18)13-23(31-24(27)12-16)21(29-15-28-5)11-17(2)14-26/h6,8-10,16-23,26H,7,11-15H2,1-5H3/b8-6+,10-9+/t16-,17+,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | USYWZVIOIRVNNK-BYLLJPMLSA-N |
| XLogP | 3.13 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|