C10H16O6 — CID 10823446
(3aR,4R,7aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one (PubChem CID 10823446) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one.
| Compound Name | (3aR,4R,7aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
|---|---|
| PubChem CID | 10823446 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3aR,4R,7aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H](O)CO)OC(=O)C[C@H]2O1 |
| InChI | InChI=1S/C10H16O6/c1-10(2)15-6-3-7(13)14-8(5(12)4-11)9(6)16-10/h5-6,8-9,11-12H,3-4H2,1-2H3/t5-,6+,8+,9+/m0/s1 |
| InChIKey | VYXMVKUQGGTAEE-HIORRCEOSA-N |
| XLogP | -0.82 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |