About (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one
(4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one (PubChem CID 11672713) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one.
Molecular Properties
| Compound Name | (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one |
| PubChem CID | 11672713 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one |
| SMILES | O=C1C[C@@H](O)[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C6H10O5/c7-2-4(9)6-3(8)1-5(10)11-6/h3-4,6-9H,1-2H2/t3-,4-,6+/m1/s1 |
| InChIKey | WIKTYYPIOVPRBF-KODRXGBYSA-N |
| XLogP | -1.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one?
The IUPAC name of (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one (CID 11672713) is (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one.
What is the SMILES notation for (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one?
The canonical SMILES for (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one is O=C1C[C@@H](O)[C@@H]([C@H](O)CO)O1.
What is the InChIKey of (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one?
The InChIKey is WIKTYYPIOVPRBF-KODRXGBYSA-N. The full InChI is InChI=1S/C6H10O5/c7-2-4(9)6-3(8)1-5(10)11-6/h3-4,6-9H,1-2H2/t3-,4-,6+/m1/s1.
What are the key properties of (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one?
(4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one has a molecular weight of 162.14 g/mol, XLogP of -1.98, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyoxolan-2-one is sourced from PubChem (CID 11672713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).