C30H58O7 — CID 89207908
1-(methoxymethoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]heptan-4-ol (PubChem CID 89207908) has the molecular formula C30H58O7 and a molecular weight of 530.79 g/mol. Its IUPAC name is 1-(methoxymethoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]heptan-4-ol.
| Compound Name | 1-(methoxymethoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]heptan-4-ol |
|---|---|
| PubChem CID | 89207908 |
| Molecular Formula | C30H58O7 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | 1-(methoxymethoxy)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]heptan-4-ol |
| SMILES | CCCCCCCCCC[C@@H](OCOC)[C@H]1CC[C@H]([C@H]2CC[C@H](C(CCC(O)CCC)OCOC)O2)O1 |
| InChI | InChI=1S/C30H58O7/c1-5-7-8-9-10-11-12-13-15-25(34-22-32-3)27-18-20-29(36-27)30-21-19-28(37-30)26(35-23-33-4)17-16-24(31)14-6-2/h24-31H,5-23H2,1-4H3/t24?,25-,26?,27-,28-,29-,30-/m1/s1 |
| InChIKey | MNIXJSJZXWMVGH-GLBIPDQGSA-N |
| XLogP | 6.53 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|