C49H92O13 — CID 10260118
methyl (4R,15R)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-4,15-bis(methoxymethoxy)-15-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]pentadecanoate (PubChem CID 10260118) has the molecular formula C49H92O13 and a molecular weight of 889.26 g/mol. Its IUPAC name is methyl (4R,15R)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-4,15-bis(methoxymethoxy)-15-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]pentadecanoate.
| Compound Name | methyl (4R,15R)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-4,15-bis(methoxymethoxy)-15-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]pentadecanoate |
|---|---|
| PubChem CID | 10260118 |
| Molecular Formula | C49H92O13 |
| Molecular Weight | 889.26 g/mol |
| Exact Mass | 888.65 |
| IUPAC Name | methyl (4R,15R)-2-[(2S)-1-hydroxy-2-(oxan-2-yloxy)propyl]-4,15-bis(methoxymethoxy)-15-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]pentadecanoate |
| SMILES | CCCCCCCCCC[C@H](OCOC)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC[C@H](CC(C(=O)OC)C(O)[C@H](C)OC3CCCCO3)OCOC)OCOC)O2)O1 |
| InChI | InChI=1S/C49H92O13/c1-7-8-9-10-11-15-18-21-26-41(58-36-53-4)43-29-31-45(61-43)46-32-30-44(62-46)42(59-37-54-5)27-22-19-16-13-12-14-17-20-25-39(57-35-52-3)34-40(49(51)55-6)48(50)38(2)60-47-28-23-24-33-56-47/h38-48,50H,7-37H2,1-6H3/t38-,39+,40?,41-,42+,43+,44+,45+,46+,47?,48?/m0/s1 |
| InChIKey | ANTOZOXXFIZQMG-GKLAUXBZSA-N |
| XLogP | 9.95 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.26 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|