C48H90O14 — CID 10581540
methyl (4R,15R)-15-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-methoxy-1,12-bis(methoxymethoxy)-15-oxopentadecyl]oxolan-2-yl]oxolan-2-yl]-4,15-bis(methoxymethoxy)pentadecanoate (PubChem CID 10581540) has the molecular formula C48H90O14 and a molecular weight of 891.23 g/mol. Its IUPAC name is methyl (4R,15R)-15-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-methoxy-1,12-bis(methoxymethoxy)-15-oxopentadecyl]oxolan-2-yl]oxolan-2-yl]-4,15-bis(methoxymethoxy)pentadecanoate.
| Compound Name | methyl (4R,15R)-15-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-methoxy-1,12-bis(methoxymethoxy)-15-oxopentadecyl]oxolan-2-yl]oxolan-2-yl]-4,15-bis(methoxymethoxy)pentadecanoate |
|---|---|
| PubChem CID | 10581540 |
| Molecular Formula | C48H90O14 |
| Molecular Weight | 891.23 g/mol |
| Exact Mass | 890.63 |
| IUPAC Name | methyl (4R,15R)-15-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-methoxy-1,12-bis(methoxymethoxy)-15-oxopentadecyl]oxolan-2-yl]oxolan-2-yl]-4,15-bis(methoxymethoxy)pentadecanoate |
| SMILES | COCO[C@H](CCCCCCCCCC[C@@H](OCOC)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC[C@H](CCC(=O)OC)OCOC)OCOC)O2)O1)CCC(=O)OC |
| InChI | InChI=1S/C48H90O14/c1-51-35-57-39(27-33-47(49)55-5)23-19-15-11-7-9-13-17-21-25-41(59-37-53-3)43-29-31-45(61-43)46-32-30-44(62-46)42(60-38-54-4)26-22-18-14-10-8-12-16-20-24-40(58-36-52-2)28-34-48(50)56-6/h39-46H,7-38H2,1-6H3/t39-,40-,41-,42-,43-,44-,45-,46-/m1/s1 |
| InChIKey | GNABPRIOYQNTBD-KFWUEBFZSA-N |
| XLogP | 9.75 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.23 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|