C43H90O9Si3 — CID 10605526
(6R)-6-[(2R,5R)-5-[(2R,5R)-5-[(1R,7S)-1,7-bis(2-trimethylsilylethoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]-6-(2-trimethylsilylethoxymethoxy)hexan-1-ol (PubChem CID 10605526) has the molecular formula C43H90O9Si3 and a molecular weight of 835.44 g/mol. Its IUPAC name is (6R)-6-[(2R,5R)-5-[(2R,5R)-5-[(1R,7S)-1,7-bis(2-trimethylsilylethoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]-6-(2-trimethylsilylethoxymethoxy)hexan-1-ol.
| Compound Name | (6R)-6-[(2R,5R)-5-[(2R,5R)-5-[(1R,7S)-1,7-bis(2-trimethylsilylethoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]-6-(2-trimethylsilylethoxymethoxy)hexan-1-ol |
|---|---|
| PubChem CID | 10605526 |
| Molecular Formula | C43H90O9Si3 |
| Molecular Weight | 835.44 g/mol |
| Exact Mass | 834.59 |
| IUPAC Name | (6R)-6-[(2R,5R)-5-[(2R,5R)-5-[(1R,7S)-1,7-bis(2-trimethylsilylethoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]-6-(2-trimethylsilylethoxymethoxy)hexan-1-ol |
| SMILES | CCCC[C@@H](CCCCC[C@@H](OCOCC[Si](C)(C)C)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCO)OCOCC[Si](C)(C)C)O2)O1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C43H90O9Si3/c1-11-12-19-37(48-34-45-28-31-53(2,3)4)20-15-13-16-21-38(49-35-46-29-32-54(5,6)7)40-23-25-42(51-40)43-26-24-41(52-43)39(22-17-14-18-27-44)50-36-47-30-33-55(8,9)10/h37-44H,11-36H2,1-10H3/t37-,38+,39+,40+,41+,42+,43+/m0/s1 |
| InChIKey | WYGROQSQTKRHTF-IHBZFKHGSA-N |
| XLogP | 10.87 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.44 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|