C33H66O8Si — CID 10483974
(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-12-(methoxymethoxy)pentadecyl]oxolan-2-yl]oxolan-2-yl]ethane-1,2-diol (PubChem CID 10483974) has the molecular formula C33H66O8Si and a molecular weight of 618.97 g/mol. Its IUPAC name is (1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-12-(methoxymethoxy)pentadecyl]oxolan-2-yl]oxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-12-(methoxymethoxy)pentadecyl]oxolan-2-yl]oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10483974 |
| Molecular Formula | C33H66O8Si |
| Molecular Weight | 618.97 g/mol |
| Exact Mass | 618.45 |
| IUPAC Name | (1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R,12R)-15-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-12-(methoxymethoxy)pentadecyl]oxolan-2-yl]oxolan-2-yl]ethane-1,2-diol |
| SMILES | COCO[C@H](CCCCCCCCCC[C@@H](O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](O)CO)O2)O1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H66O8Si/c1-33(2,3)42(5,6)39-23-15-17-26(38-25-37-4)16-13-11-9-7-8-10-12-14-18-27(35)29-19-21-31(40-29)32-22-20-30(41-32)28(36)24-34/h26-32,34-36H,7-25H2,1-6H3/t26-,27-,28+,29-,30-,31-,32-/m1/s1 |
| InChIKey | FUPGUCMSHDINRG-KIBGMTCCSA-N |
| XLogP | 6.49 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.97 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|