C37H66O6Si — CID 87530115
1-[5-[5-[6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)deca-2,9-diynyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol (PubChem CID 87530115) has the molecular formula C37H66O6Si and a molecular weight of 635.02 g/mol. Its IUPAC name is 1-[5-[5-[6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)deca-2,9-diynyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol.
| Compound Name | 1-[5-[5-[6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)deca-2,9-diynyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
|---|---|
| PubChem CID | 87530115 |
| Molecular Formula | C37H66O6Si |
| Molecular Weight | 635.02 g/mol |
| Exact Mass | 634.46 |
| IUPAC Name | 1-[5-[5-[6-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)deca-2,9-diynyl]oxolan-2-yl]oxolan-2-yl]undecan-1-ol |
| SMILES | C#CCCC(CCC#CC(OCOC)C1CCC(C2CCC(C(O)CCCCCCCCCC)O2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H66O6Si/c1-9-11-13-14-15-16-17-18-23-31(38)32-25-26-35(41-32)36-28-27-34(42-36)33(40-29-39-6)24-20-19-22-30(21-12-10-2)43-44(7,8)37(3,4)5/h2,30-36,38H,9,11-19,21-23,25-29H2,1,3-8H3 |
| InChIKey | INQZPWQQHAJULY-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.02 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|