C39H70O7Si — CID 76585895
tert-butyl-[10-(methoxymethoxy)-10-[5-[5-[1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]deca-1,8-diyn-5-yl]oxy-dimethylsilane (PubChem CID 76585895) has the molecular formula C39H70O7Si and a molecular weight of 679.07 g/mol. Its IUPAC name is tert-butyl-[10-(methoxymethoxy)-10-[5-[5-[1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]deca-1,8-diyn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[10-(methoxymethoxy)-10-[5-[5-[1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]deca-1,8-diyn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 76585895 |
| Molecular Formula | C39H70O7Si |
| Molecular Weight | 679.07 g/mol |
| Exact Mass | 678.49 |
| IUPAC Name | tert-butyl-[10-(methoxymethoxy)-10-[5-[5-[1-(methoxymethoxy)undecyl]oxolan-2-yl]oxolan-2-yl]deca-1,8-diyn-5-yl]oxy-dimethylsilane |
| SMILES | C#CCCC(CCC#CC(OCOC)C1CCC(C2CCC(C(CCCCCCCCCC)OCOC)O2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H70O7Si/c1-10-12-14-15-16-17-18-19-24-33(42-30-40-6)35-26-28-37(44-35)38-29-27-36(45-38)34(43-31-41-7)25-21-20-23-32(22-13-11-2)46-47(8,9)39(3,4)5/h2,32-38H,10,12-20,22-24,26-31H2,1,3-9H3 |
| InChIKey | UFRKCMNHLCBYDR-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.07 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|