C30H40O5 — CID 177491474
(2R,6Z,9R)-8-[(4-methoxyphenyl)methoxy]-9-methyl-2-pentyl-3-phenylmethoxy-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 177491474) has the molecular formula C30H40O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2R,6Z,9R)-8-[(4-methoxyphenyl)methoxy]-9-methyl-2-pentyl-3-phenylmethoxy-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,6Z,9R)-8-[(4-methoxyphenyl)methoxy]-9-methyl-2-pentyl-3-phenylmethoxy-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 177491474 |
| Molecular Formula | C30H40O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (2R,6Z,9R)-8-[(4-methoxyphenyl)methoxy]-9-methyl-2-pentyl-3-phenylmethoxy-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCC[C@H]1OC(=O)[C@H](C)C(OCc2ccc(OC)cc2)/C=C\CCC1OCc1ccccc1 |
| InChI | InChI=1S/C30H40O5/c1-4-5-7-16-29-28(34-21-24-12-8-6-9-13-24)15-11-10-14-27(23(2)30(31)35-29)33-22-25-17-19-26(32-3)20-18-25/h6,8-10,12-14,17-20,23,27-29H,4-5,7,11,15-16,21-22H2,1-3H3/b14-10-/t23-,27?,28?,29-/m1/s1 |
| InChIKey | CYELWCDAFGNUNE-CDWAOYBNSA-N |
| XLogP | 6.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|