C31H34O5 — CID 10844304
[(1R,4Z,6R,7S,8S)-6,7,8-tris(phenylmethoxy)cyclooct-4-en-1-yl] acetate (PubChem CID 10844304) has the molecular formula C31H34O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is [(1R,4Z,6R,7S,8S)-6,7,8-tris(phenylmethoxy)cyclooct-4-en-1-yl] acetate.
| Compound Name | [(1R,4Z,6R,7S,8S)-6,7,8-tris(phenylmethoxy)cyclooct-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 10844304 |
| Molecular Formula | C31H34O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [(1R,4Z,6R,7S,8S)-6,7,8-tris(phenylmethoxy)cyclooct-4-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC/C=C\[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34O5/c1-24(32)36-29-20-12-11-19-28(33-21-25-13-5-2-6-14-25)30(34-22-26-15-7-3-8-16-26)31(29)35-23-27-17-9-4-10-18-27/h2-11,13-19,28-31H,12,20-23H2,1H3/b19-11-/t28-,29-,30+,31+/m1/s1 |
| InChIKey | WUXXTZWMADXEKO-HVONDBRPSA-N |
| XLogP | 6.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|